WolfBandit47 WolfBandit47
  • 01-12-2021
  • Computers and Technology
contestada

Edward scissorhands Of course, Jim is the villain, but who or what is the antagonist in the film? Explain in detail.

Respuesta :

TwilightSaga1901
TwilightSaga1901 TwilightSaga1901
  • 01-12-2021
Jim is the main antagonist while Edward is the main protagonist of the movie.
Answer Link

Otras preguntas

How did 1930’s reflect art and music
1) List two equivalent fractions for 2/8. One number 1 I don’t know where to start
Does the sentence state a fact or an opinion? Dish soap, olive oil, and water won't mix in a container because they each have a different density, or mass in a
cosec(6b+pi/8)=sec(2b-pi/8)​
The cartoon comments on tactics used to
two legs of a right triangle each measure 10 incles how long is the hypotenuse
What is 0.873175 rounded to the nearest hundredth
What is the sum? 3/8 +7/16 A) 5/12 B) 13/16 C) 7/8 D) 1 3/16
In what way do people discriminate against teenagers?
Given sin t= 2/5 and cos t>0, find cos t