raaeraae22
raaeraae22
04-02-2017
Chemistry
contestada
When is di- used in the name of a hydrocarbon?
Respuesta :
DoctorCass
DoctorCass
04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link
VER TODAS LAS RESPUESTAS ( 29+ )
Otras preguntas
What is the climate like in the Himalayas, India?
College students are offered a 8% discount on a textbook that sells for 26.50. If the sales tax is 8, find the cost of the textbook including sales tax.
How did the efforts of A. Philip Randolph help further civil rights in the United States? He demanded that minorities be allowed to serve in non-segregated unit
Which personal pronoun correctly completes the sentence? A flock of birds flew over __________. A. we B. his C. they D. them
What are at least three things a colony needs to successfully achieve autonomy? democratic form of government capitalistic economic system numerous treaties wit
Which words in the sentence make up the adverb phrase? Todd built an impressive model bridge with glue and craft sticks. A. with glue and craft sticks B. Todd b
a normal window is constructed by adjoining a semicircle to the top of an ordinary rectangular window, (see figure ) The perimeter of the window is 12 feet. wh
How are fossils of extinct organisms included in branching diagrams
describe two different ways that a pollen grain can get to the stigma of a pistil ?
the flight of an aircraft from toronto to montrel can be modelled by he relation h=-2.5t2+200t where t is the time, in minutes, and h is the height in metre
