Jacob2175 Jacob2175

04-04-2017
History

contestada

Why did the Spanish start bringing African slaves to their new world colonies in the early 1500's

Respuesta :

pinkcamohannah101 pinkcamohannah101

04-04-2017

I take spanish and I'm in middle school I don't understand the question 100% but if you are needing translations you can go to spanishdictionary.com

Answer Link

Otras preguntas

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Our microscopes have three objectives. What are their powers?

Please help I will reward brainly!!

Fill in the blank with the future tense of the verb in parentheses. Mis amigos no ___________ ir conmigo. (querer) Answer for Blank 1: Question 6 (Fill-In-T

Which of the following things will we NOT learn from studying fossils? (2 points) A. How living things change over time B. The sounds animals made C. The type o

HCl + NaOH → NaCl + H2O 1. If 30g of HCl is reacted with excess NaOH, and 10g of NaCl is produced, what is the theoretical yield of the experiment? 2. If 30 g o

What is the value of log625^5 A.-4 B.-1/4 C. 1/4 D.4

How is water necessary for the structure of a green plant?

HELP Which statement best describes the shaded region in the Venn diagram?

Please answer!The radius of this circle is 4 units. Estimate the area of the circle by counting the squares within the circle.